About benzylidene(chloro)ruthenium;tricyclohexylphosphane
benzylidene(chloro)ruthenium;tricyclohexylphosphane (PubChem CID 173136823) has the molecular formula C25H39ClPRu
and a molecular weight of 507.08 g/mol. Its IUPAC name is benzylidene(chloro)ruthenium;tricyclohexylphosphane.
Molecular Properties
| Compound Name | benzylidene(chloro)ruthenium;tricyclohexylphosphane |
| PubChem CID | 173136823 |
| Molecular Formula | C25H39ClPRu |
| Molecular Weight | 507.08 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | benzylidene(chloro)ruthenium;tricyclohexylphosphane |
| SMILES | C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.Cl/[Ru]=C/c1ccccc1 |
| InChI | InChI=1S/C18H33P.C7H6.ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-3-2-4-6-7;;/h16-18H,1-15H2;1-6H;1H;/q;;;+1/p-1 |
| InChIKey | ZSZKWAGHMIOTFN-UHFFFAOYSA-M |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.08 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzylidene(chloro)ruthenium;tricyclohexylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylidene(chloro)ruthenium;tricyclohexylphosphane?
The IUPAC name of benzylidene(chloro)ruthenium;tricyclohexylphosphane (CID 173136823) is benzylidene(chloro)ruthenium;tricyclohexylphosphane.
What is the SMILES notation for benzylidene(chloro)ruthenium;tricyclohexylphosphane?
The canonical SMILES for benzylidene(chloro)ruthenium;tricyclohexylphosphane is C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.Cl/[Ru]=C/c1ccccc1.
What is the InChIKey of benzylidene(chloro)ruthenium;tricyclohexylphosphane?
The InChIKey is ZSZKWAGHMIOTFN-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H33P.C7H6.ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-3-2-4-6-7;;/h16-18H,1-15H2;1-6H;1H;/q;;;+1/p-1.
What are the key properties of benzylidene(chloro)ruthenium;tricyclohexylphosphane?
benzylidene(chloro)ruthenium;tricyclohexylphosphane has a molecular weight of 507.08 g/mol, XLogP of 8.54, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzylidene(chloro)ruthenium;tricyclohexylphosphane is sourced from PubChem (CID 173136823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).