About dichloronickel;toluene;tricyclohexylphosphane
dichloronickel;toluene;tricyclohexylphosphane (PubChem CID 174762533) has the molecular formula C25H41Cl2NiP
and a molecular weight of 502.18 g/mol. Its IUPAC name is dichloronickel;toluene;tricyclohexylphosphane.
Molecular Properties
| Compound Name | dichloronickel;toluene;tricyclohexylphosphane |
| PubChem CID | 174762533 |
| Molecular Formula | C25H41Cl2NiP |
| Molecular Weight | 502.18 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | dichloronickel;toluene;tricyclohexylphosphane |
| SMILES | C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.Cc1ccccc1.Cl[Ni]Cl |
| InChI | InChI=1S/C18H33P.C7H8.2ClH.Ni/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-3-2-4-6-7;;;/h16-18H,1-15H2;2-6H,1H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | PXFAJXIGJHZFRG-UHFFFAOYSA-L |
| XLogP | 9.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 502.18 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloronickel;toluene;tricyclohexylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloronickel;toluene;tricyclohexylphosphane?
The IUPAC name of dichloronickel;toluene;tricyclohexylphosphane (CID 174762533) is dichloronickel;toluene;tricyclohexylphosphane.
What is the SMILES notation for dichloronickel;toluene;tricyclohexylphosphane?
The canonical SMILES for dichloronickel;toluene;tricyclohexylphosphane is C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.Cc1ccccc1.Cl[Ni]Cl.
What is the InChIKey of dichloronickel;toluene;tricyclohexylphosphane?
The InChIKey is PXFAJXIGJHZFRG-UHFFFAOYSA-L. The full InChI is InChI=1S/C18H33P.C7H8.2ClH.Ni/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-3-2-4-6-7;;;/h16-18H,1-15H2;2-6H,1H3;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloronickel;toluene;tricyclohexylphosphane?
dichloronickel;toluene;tricyclohexylphosphane has a molecular weight of 502.18 g/mol, XLogP of 9.84, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloronickel;toluene;tricyclohexylphosphane is sourced from PubChem (CID 174762533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).