About (2-benzylidene-4,4-dichlorocyclohexyl)-dicyclohexylphosphane;ruthenium
(2-benzylidene-4,4-dichlorocyclohexyl)-dicyclohexylphosphane;ruthenium (PubChem CID 160502510) has the molecular formula C25H35Cl2PRu
and a molecular weight of 538.51 g/mol. Its IUPAC name is (2-benzylidene-4,4-dichlorocyclohexyl)-dicyclohexylphosphane;ruthenium.
Molecular Properties
| Compound Name | (2-benzylidene-4,4-dichlorocyclohexyl)-dicyclohexylphosphane;ruthenium |
| PubChem CID | 160502510 |
| Molecular Formula | C25H35Cl2PRu |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | (2-benzylidene-4,4-dichlorocyclohexyl)-dicyclohexylphosphane;ruthenium |
| SMILES | ClC1(Cl)CCC(P(C2CCCCC2)C2CCCCC2)C(=Cc2ccccc2)C1.[Ru] |
| InChI | InChI=1S/C25H35Cl2P.Ru/c26-25(27)17-16-24(21(19-25)18-20-10-4-1-5-11-20)28(22-12-6-2-7-13-22)23-14-8-3-9-15-23;/h1,4-5,10-11,18,22-24H,2-3,6-9,12-17,19H2; |
| InChIKey | QRYUWHZLERRDDR-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-benzylidene-4,4-dichlorocyclohexyl)-dicyclohexylphosphane;ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzylidene-4,4-dichlorocyclohexyl)-dicyclohexylphosphane;ruthenium?
The IUPAC name of (2-benzylidene-4,4-dichlorocyclohexyl)-dicyclohexylphosphane;ruthenium (CID 160502510) is (2-benzylidene-4,4-dichlorocyclohexyl)-dicyclohexylphosphane;ruthenium.
What is the SMILES notation for (2-benzylidene-4,4-dichlorocyclohexyl)-dicyclohexylphosphane;ruthenium?
The canonical SMILES for (2-benzylidene-4,4-dichlorocyclohexyl)-dicyclohexylphosphane;ruthenium is ClC1(Cl)CCC(P(C2CCCCC2)C2CCCCC2)C(=Cc2ccccc2)C1.[Ru].
What is the InChIKey of (2-benzylidene-4,4-dichlorocyclohexyl)-dicyclohexylphosphane;ruthenium?
The InChIKey is QRYUWHZLERRDDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35Cl2P.Ru/c26-25(27)17-16-24(21(19-25)18-20-10-4-1-5-11-20)28(22-12-6-2-7-13-22)23-14-8-3-9-15-23;/h1,4-5,10-11,18,22-24H,2-3,6-9,12-17,19H2;.
What are the key properties of (2-benzylidene-4,4-dichlorocyclohexyl)-dicyclohexylphosphane;ruthenium?
(2-benzylidene-4,4-dichlorocyclohexyl)-dicyclohexylphosphane;ruthenium has a molecular weight of 538.51 g/mol, XLogP of 8.94, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzylidene-4,4-dichlorocyclohexyl)-dicyclohexylphosphane;ruthenium is sourced from PubChem (CID 160502510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).