C53H69Cl2N2PRu — CID 159105378
[3-benzylidene-2-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]cyclohexyl]-dicyclohexylphosphane;dichlororuthenium;toluene (PubChem CID 159105378) has the molecular formula C53H69Cl2N2PRu and a molecular weight of 937.10 g/mol. Its IUPAC name is [3-benzylidene-2-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]cyclohexyl]-dicyclohexylphosphane;dichlororuthenium;toluene.
| Compound Name | [3-benzylidene-2-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]cyclohexyl]-dicyclohexylphosphane;dichlororuthenium;toluene |
|---|---|
| PubChem CID | 159105378 |
| Molecular Formula | C53H69Cl2N2PRu |
| Molecular Weight | 937.10 g/mol |
| Exact Mass | 936.36 |
| IUPAC Name | [3-benzylidene-2-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]cyclohexyl]-dicyclohexylphosphane;dichlororuthenium;toluene |
| SMILES | Cc1cc(C)c(N2CCN(c3c(C)cc(C)cc3C)C2=C2C(=Cc3ccccc3)CCCC2P(C2CCCCC2)C2CCCCC2)c(C)c1.Cc1ccccc1.Cl[Ru]Cl |
| InChI | InChI=1S/C46H61N2P.C7H8.2ClH.Ru/c1-32-27-34(3)44(35(4)28-32)47-25-26-48(45-36(5)29-33(2)30-37(45)6)46(47)43-39(31-38-17-10-7-11-18-38)19-16-24-42(43)49(40-20-12-8-13-21-40)41-22-14-9-15-23-41;1-7-5-3-2-4-6-7;;;/h7,10-11,17-18,27-31,40-42H,8-9,12-16,19-26H2,1-6H3;2-6H,1H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | KDUVMICCRXSWJD-UHFFFAOYSA-L |
| XLogP | 16.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.10 |
| LogP ≤ 5 | 16.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|