C46H59Cl2N2P — CID 159510451
[2-benzylidene-3-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-1,4-dichlorocyclohexyl]-dicyclohexylphosphane (PubChem CID 159510451) has the molecular formula C46H59Cl2N2P and a molecular weight of 741.87 g/mol. Its IUPAC name is [2-benzylidene-3-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-1,4-dichlorocyclohexyl]-dicyclohexylphosphane.
| Compound Name | [2-benzylidene-3-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-1,4-dichlorocyclohexyl]-dicyclohexylphosphane |
|---|---|
| PubChem CID | 159510451 |
| Molecular Formula | C46H59Cl2N2P |
| Molecular Weight | 741.87 g/mol |
| Exact Mass | 740.38 |
| IUPAC Name | [2-benzylidene-3-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ylidene]-1,4-dichlorocyclohexyl]-dicyclohexylphosphane |
| SMILES | Cc1cc(C)c(N2CCN(c3c(C)cc(C)cc3C)C2=C2C(=Cc3ccccc3)C(Cl)(P(C3CCCCC3)C3CCCCC3)CCC2Cl)c(C)c1 |
| InChI | InChI=1S/C46H59Cl2N2P/c1-31-26-33(3)43(34(4)27-31)49-24-25-50(44-35(5)28-32(2)29-36(44)6)45(49)42-40(30-37-16-10-7-11-17-37)46(48,23-22-41(42)47)51(38-18-12-8-13-19-38)39-20-14-9-15-21-39/h7,10-11,16-17,26-30,38-39,41H,8-9,12-15,18-25H2,1-6H3 |
| InChIKey | IRCNFSMSYOXMIZ-UHFFFAOYSA-N |
| XLogP | 13.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.87 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|