C46H61Cl2N2PRu — CID 175746135
[2-benzylidene-3-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-yl]-1,3-dichlorocyclohexyl]-dicyclohexylphosphane;ruthenium (PubChem CID 175746135) has the molecular formula C46H61Cl2N2PRu and a molecular weight of 844.96 g/mol. Its IUPAC name is [2-benzylidene-3-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-yl]-1,3-dichlorocyclohexyl]-dicyclohexylphosphane;ruthenium.
| Compound Name | [2-benzylidene-3-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-yl]-1,3-dichlorocyclohexyl]-dicyclohexylphosphane;ruthenium |
|---|---|
| PubChem CID | 175746135 |
| Molecular Formula | C46H61Cl2N2PRu |
| Molecular Weight | 844.96 g/mol |
| Exact Mass | 844.30 |
| IUPAC Name | [2-benzylidene-3-[1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-yl]-1,3-dichlorocyclohexyl]-dicyclohexylphosphane;ruthenium |
| SMILES | Cc1cc(C)c(N2CCN(c3c(C)cc(C)cc3C)C2C2(Cl)CCCC(Cl)(P(C3CCCCC3)C3CCCCC3)C2=Cc2ccccc2)c(C)c1.[Ru] |
| InChI | InChI=1S/C46H61Cl2N2P.Ru/c1-32-27-34(3)42(35(4)28-32)49-25-26-50(43-36(5)29-33(2)30-37(43)6)44(49)45(47)23-16-24-46(48,41(45)31-38-17-10-7-11-18-38)51(39-19-12-8-13-20-39)40-21-14-9-15-22-40;/h7,10-11,17-18,27-31,39-40,44H,8-9,12-16,19-26H2,1-6H3; |
| InChIKey | GHBKAQXKBXLVSI-UHFFFAOYSA-N |
| XLogP | 13.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 844.96 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|