C25H37Cl2I3PRu — CID 175844699
benzylidene-dicyclohexyl-(4,4-dichlorocyclohexyl)-λ5-phosphane;triiodoruthenium (PubChem CID 175844699) has the molecular formula C25H37Cl2I3PRu and a molecular weight of 921.23 g/mol. Its IUPAC name is benzylidene-dicyclohexyl-(4,4-dichlorocyclohexyl)-λ5-phosphane;triiodoruthenium.
| Compound Name | benzylidene-dicyclohexyl-(4,4-dichlorocyclohexyl)-λ5-phosphane;triiodoruthenium |
|---|---|
| PubChem CID | 175844699 |
| Molecular Formula | C25H37Cl2I3PRu |
| Molecular Weight | 921.23 g/mol |
| Exact Mass | 920.82 |
| IUPAC Name | benzylidene-dicyclohexyl-(4,4-dichlorocyclohexyl)-λ5-phosphane;triiodoruthenium |
| SMILES | ClC1(Cl)CCC(P(=Cc2ccccc2)(C2CCCCC2)C2CCCCC2)CC1.I[Ru](I)I |
| InChI | InChI=1S/C25H37Cl2P.3HI.Ru/c26-25(27)18-16-24(17-19-25)28(22-12-6-2-7-13-22,23-14-8-3-9-15-23)20-21-10-4-1-5-11-21;;;;/h1,4-5,10-11,20,22-24H,2-3,6-9,12-19H2;3*1H;/q;;;;+3/p-3 |
| InChIKey | JPXZHQBKQNCMQO-UHFFFAOYSA-K |
| XLogP | 11.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.23 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|