C25H35I2PRu — CID 157365293
(2-benzylidene-1,3-diiodocyclohexyl)-dicyclohexylphosphane;ruthenium (PubChem CID 157365293) has the molecular formula C25H35I2PRu and a molecular weight of 721.41 g/mol. Its IUPAC name is (2-benzylidene-1,3-diiodocyclohexyl)-dicyclohexylphosphane;ruthenium.
| Compound Name | (2-benzylidene-1,3-diiodocyclohexyl)-dicyclohexylphosphane;ruthenium |
|---|---|
| PubChem CID | 157365293 |
| Molecular Formula | C25H35I2PRu |
| Molecular Weight | 721.41 g/mol |
| Exact Mass | 721.96 |
| IUPAC Name | (2-benzylidene-1,3-diiodocyclohexyl)-dicyclohexylphosphane;ruthenium |
| SMILES | IC1CCCC(I)(P(C2CCCCC2)C2CCCCC2)C1=Cc1ccccc1.[Ru] |
| InChI | InChI=1S/C25H35I2P.Ru/c26-24-17-10-18-25(27,23(24)19-20-11-4-1-5-12-20)28(21-13-6-2-7-14-21)22-15-8-3-9-16-22;/h1,4-5,11-12,19,21-22,24H,2-3,6-10,13-18H2; |
| InChIKey | BJCKPHTZWHEIAP-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.41 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|