C26H38ClO2P — CID 175706079
dicyclohexyl-(1,3-dimethoxy-2-phenylcyclohexa-2,4-dien-1-yl)phosphane;hydrochloride (PubChem CID 175706079) has the molecular formula C26H38ClO2P and a molecular weight of 449.02 g/mol. Its IUPAC name is dicyclohexyl-(1,3-dimethoxy-2-phenylcyclohexa-2,4-dien-1-yl)phosphane;hydrochloride.
| Compound Name | dicyclohexyl-(1,3-dimethoxy-2-phenylcyclohexa-2,4-dien-1-yl)phosphane;hydrochloride |
|---|---|
| PubChem CID | 175706079 |
| Molecular Formula | C26H38ClO2P |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | dicyclohexyl-(1,3-dimethoxy-2-phenylcyclohexa-2,4-dien-1-yl)phosphane;hydrochloride |
| SMILES | COC1=C(c2ccccc2)C(OC)(P(C2CCCCC2)C2CCCCC2)CC=C1.Cl |
| InChI | InChI=1S/C26H37O2P.ClH/c1-27-24-19-12-20-26(28-2,25(24)21-13-6-3-7-14-21)29(22-15-8-4-9-16-22)23-17-10-5-11-18-23;/h3,6-7,12-14,19,22-23H,4-5,8-11,15-18,20H2,1-2H3;1H |
| InChIKey | KDBPRNFOGNGKHB-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|