C26H39O6PS — CID 175212957
6-dicyclohexylphosphanyl-4,6-dimethoxy-5-phenylcyclohexa-2,4-diene-1-sulfonic acid;hydrate (PubChem CID 175212957) has the molecular formula C26H39O6PS and a molecular weight of 510.63 g/mol. Its IUPAC name is 6-dicyclohexylphosphanyl-4,6-dimethoxy-5-phenylcyclohexa-2,4-diene-1-sulfonic acid;hydrate.
| Compound Name | 6-dicyclohexylphosphanyl-4,6-dimethoxy-5-phenylcyclohexa-2,4-diene-1-sulfonic acid;hydrate |
|---|---|
| PubChem CID | 175212957 |
| Molecular Formula | C26H39O6PS |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 6-dicyclohexylphosphanyl-4,6-dimethoxy-5-phenylcyclohexa-2,4-diene-1-sulfonic acid;hydrate |
| SMILES | COC1=C(c2ccccc2)C(OC)(P(C2CCCCC2)C2CCCCC2)C(S(=O)(=O)O)C=C1.O |
| InChI | InChI=1S/C26H37O5PS.H2O/c1-30-23-18-19-24(33(27,28)29)26(31-2,25(23)20-12-6-3-7-13-20)32(21-14-8-4-9-15-21)22-16-10-5-11-17-22;/h3,6-7,12-13,18-19,21-22,24H,4-5,8-11,14-17H2,1-2H3,(H,27,28,29);1H2 |
| InChIKey | XJMYYHJNBWLSQF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 104.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|