C18H24N2 — CID 175919182
4-cyclohexyl-5-phenylcyclohexa-1,5-diene-1,4-diamine (PubChem CID 175919182) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-cyclohexyl-5-phenylcyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 4-cyclohexyl-5-phenylcyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 175919182 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 4-cyclohexyl-5-phenylcyclohexa-1,5-diene-1,4-diamine |
| SMILES | NC1=CCC(N)(C2CCCCC2)C(c2ccccc2)=C1 |
| InChI | InChI=1S/C18H24N2/c19-16-11-12-18(20,15-9-5-2-6-10-15)17(13-16)14-7-3-1-4-8-14/h1,3-4,7-8,11,13,15H,2,5-6,9-10,12,19-20H2 |
| InChIKey | UOQIHKDQBHJDMC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |