C16H18O — CID 102275488
(3aS,7aS)-1-phenyl-3,4,5,6,7,7a-hexahydroindene-3a-carbaldehyde (PubChem CID 102275488) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is (3aS,7aS)-1-phenyl-3,4,5,6,7,7a-hexahydroindene-3a-carbaldehyde.
| Compound Name | (3aS,7aS)-1-phenyl-3,4,5,6,7,7a-hexahydroindene-3a-carbaldehyde |
|---|---|
| PubChem CID | 102275488 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | (3aS,7aS)-1-phenyl-3,4,5,6,7,7a-hexahydroindene-3a-carbaldehyde |
| SMILES | O=C[C@@]12CC=C(c3ccccc3)[C@@H]1CCCC2 |
| InChI | InChI=1S/C16H18O/c17-12-16-10-5-4-8-15(16)14(9-11-16)13-6-2-1-3-7-13/h1-3,6-7,9,12,15H,4-5,8,10-11H2/t15-,16+/m0/s1 |
| InChIKey | SPJBDUYWQKKZPV-JKSUJKDBSA-N |
| XLogP | 3.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|