C44H59Cl2N2PRu — CID 20598498
benzylidene-[1,3-bis[(1R)-1-phenylethyl]imidazol-2-ylidene]-dichlororuthenium;tricyclohexylphosphane (PubChem CID 20598498) has the molecular formula C44H59Cl2N2PRu and a molecular weight of 818.92 g/mol. Its IUPAC name is benzylidene-[1,3-bis[(1R)-1-phenylethyl]imidazol-2-ylidene]-dichlororuthenium;tricyclohexylphosphane.
| Compound Name | benzylidene-[1,3-bis[(1R)-1-phenylethyl]imidazol-2-ylidene]-dichlororuthenium;tricyclohexylphosphane |
|---|---|
| PubChem CID | 20598498 |
| Molecular Formula | C44H59Cl2N2PRu |
| Molecular Weight | 818.92 g/mol |
| Exact Mass | 818.28 |
| IUPAC Name | benzylidene-[1,3-bis[(1R)-1-phenylethyl]imidazol-2-ylidene]-dichlororuthenium;tricyclohexylphosphane |
| SMILES | C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.C[C@H](c1ccccc1)n1ccn([C@H](C)c2ccccc2)c1=[Ru](Cl)(Cl)=Cc1ccccc1 |
| InChI | InChI=1S/C19H20N2.C18H33P.C7H6.2ClH.Ru/c1-16(18-9-5-3-6-10-18)20-13-14-21(15-20)17(2)19-11-7-4-8-12-19;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-3-2-4-6-7;;;/h3-14,16-17H,1-2H3;16-18H,1-15H2;1-6H;2*1H;/q;;;;;+2/p-2/t16-,17-;;;;;/m1...../s1 |
| InChIKey | LEJOOOOTPCEGSJ-LDOKQJGJSA-L |
| XLogP | 13.82 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.92 |
| LogP ≤ 5 | 13.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|