C34H46ClN2OPRu- — CID 153489756
1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;cyclohexylphosphane (PubChem CID 153489756) has the molecular formula C34H46ClN2OPRu- and a molecular weight of 666.25 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;cyclohexylphosphane.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;cyclohexylphosphane |
|---|---|
| PubChem CID | 153489756 |
| Molecular Formula | C34H46ClN2OPRu- |
| Molecular Weight | 666.25 g/mol |
| Exact Mass | 666.21 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;cyclohexylphosphane |
| SMILES | Cc1cc(C)c(N2[CH-]N(c3c(C)cc(C)cc3C)CC2)c(C)c1.Oc1ccccc1/C=[Ru]\Cl.PC1CCCCC1 |
| InChI | InChI=1S/C21H27N2.C7H6O.C6H13P.ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-6-4-2-3-5-7(6)8;7-6-4-2-1-3-5-6;;/h9-13H,7-8H2,1-6H3;1-5,8H;6H,1-5,7H2;1H;/q-1;;;;+1/p-1 |
| InChIKey | PDOQTEUXOFIPDO-UHFFFAOYSA-M |
| XLogP | 8.96 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.25 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|