C33H44ClN2ORu-2 — CID 59685243
1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;carbanide;chloro-[[2-[methanidyl(propan-2-yl)oxonio]phenyl]methylidene]ruthenium (PubChem CID 59685243) has the molecular formula C33H44ClN2ORu-2 and a molecular weight of 621.25 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;carbanide;chloro-[[2-[methanidyl(propan-2-yl)oxonio]phenyl]methylidene]ruthenium.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;carbanide;chloro-[[2-[methanidyl(propan-2-yl)oxonio]phenyl]methylidene]ruthenium |
|---|---|
| PubChem CID | 59685243 |
| Molecular Formula | C33H44ClN2ORu-2 |
| Molecular Weight | 621.25 g/mol |
| Exact Mass | 621.22 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;carbanide;chloro-[[2-[methanidyl(propan-2-yl)oxonio]phenyl]methylidene]ruthenium |
| SMILES | Cc1cc(C)c(N2[CH-]N(c3c(C)cc(C)cc3C)CC2)c(C)c1.[CH2-][O+](c1ccccc1/C=[Ru]/Cl)C(C)C.[CH3-] |
| InChI | InChI=1S/C21H27N2.C11H14O.CH3.ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-9(2)12(4)11-8-6-5-7-10(11)3;;;/h9-13H,7-8H2,1-6H3;3,5-9H,4H2,1-2H3;1H3;1H;/q-1;;-1;;+1/p-1 |
| InChIKey | UXQXAPXMFMXOGE-UHFFFAOYSA-M |
| XLogP | 8.97 |
| TPSA | 9.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.25 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|