C33H44ClN3O3RuS- — CID 58568239
1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;chloro-[[5-(dimethylsulfamoyl)-2-propan-2-yloxyphenyl]methylidene]ruthenium (PubChem CID 58568239) has the molecular formula C33H44ClN3O3RuS- and a molecular weight of 699.32 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;chloro-[[5-(dimethylsulfamoyl)-2-propan-2-yloxyphenyl]methylidene]ruthenium.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;chloro-[[5-(dimethylsulfamoyl)-2-propan-2-yloxyphenyl]methylidene]ruthenium |
|---|---|
| PubChem CID | 58568239 |
| Molecular Formula | C33H44ClN3O3RuS- |
| Molecular Weight | 699.32 g/mol |
| Exact Mass | 699.18 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide;chloro-[[5-(dimethylsulfamoyl)-2-propan-2-yloxyphenyl]methylidene]ruthenium |
| SMILES | CC(C)Oc1ccc(S(=O)(=O)N(C)C)cc1/C=[Ru]\Cl.Cc1cc(C)c(N2[CH-]N(c3c(C)cc(C)cc3C)CC2)c(C)c1 |
| InChI | InChI=1S/C21H27N2.C12H17NO3S.ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-9(2)16-12-7-6-11(8-10(12)3)17(14,15)13(4)5;;/h9-13H,7-8H2,1-6H3;3,6-9H,1-2,4-5H3;1H;/q-1;;;+1/p-1 |
| InChIKey | ZRDQRDHMEJDVAB-UHFFFAOYSA-M |
| XLogP | 7.09 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.32 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|