C19H25N3O5S2 — CID 74406058
N,N-dimethyl-3-[[(4-methylphenyl)sulfonylhydrazinylidene]methyl]-4-propan-2-yloxybenzenesulfonamide (PubChem CID 74406058) has the molecular formula C19H25N3O5S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is N,N-dimethyl-3-[[(4-methylphenyl)sulfonylhydrazinylidene]methyl]-4-propan-2-yloxybenzenesulfonamide.
| Compound Name | N,N-dimethyl-3-[[(4-methylphenyl)sulfonylhydrazinylidene]methyl]-4-propan-2-yloxybenzenesulfonamide |
|---|---|
| PubChem CID | 74406058 |
| Molecular Formula | C19H25N3O5S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N,N-dimethyl-3-[[(4-methylphenyl)sulfonylhydrazinylidene]methyl]-4-propan-2-yloxybenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN=Cc2cc(S(=O)(=O)N(C)C)ccc2OC(C)C)cc1 |
| InChI | InChI=1S/C19H25N3O5S2/c1-14(2)27-19-11-10-18(29(25,26)22(4)5)12-16(19)13-20-21-28(23,24)17-8-6-15(3)7-9-17/h6-14,21H,1-5H3 |
| InChIKey | QEEMFPJENXGDAU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|