C17H18F2N2O4S — CID 9073491
N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-4-methylbenzenesulfonamide (PubChem CID 9073491) has the molecular formula C17H18F2N2O4S and a molecular weight of 384.40 g/mol. Its IUPAC name is N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 9073491 |
| Molecular Formula | C17H18F2N2O4S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-[(Z)-[2-(difluoromethoxy)-3-ethoxyphenyl]methylideneamino]-4-methylbenzenesulfonamide |
| SMILES | CCOc1cccc(/C=N\NS(=O)(=O)c2ccc(C)cc2)c1OC(F)F |
| InChI | InChI=1S/C17H18F2N2O4S/c1-3-24-15-6-4-5-13(16(15)25-17(18)19)11-20-21-26(22,23)14-9-7-12(2)8-10-14/h4-11,17,21H,3H2,1-2H3/b20-11- |
| InChIKey | BOVTUZHRDZRUEN-JAIQZWGSSA-N |
| XLogP | 3.31 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|