C42H61Cl2N2ORu- — CID 59685354
1,3-bis(3,5-ditert-butylphenyl)imidazolidin-2-ide;dichloro-[[2-[methanidyl(propan-2-yl)oxonio]phenyl]methylidene]ruthenium (PubChem CID 59685354) has the molecular formula C42H61Cl2N2ORu- and a molecular weight of 781.94 g/mol. Its IUPAC name is 1,3-bis(3,5-ditert-butylphenyl)imidazolidin-2-ide;dichloro-[[2-[methanidyl(propan-2-yl)oxonio]phenyl]methylidene]ruthenium.
| Compound Name | 1,3-bis(3,5-ditert-butylphenyl)imidazolidin-2-ide;dichloro-[[2-[methanidyl(propan-2-yl)oxonio]phenyl]methylidene]ruthenium |
|---|---|
| PubChem CID | 59685354 |
| Molecular Formula | C42H61Cl2N2ORu- |
| Molecular Weight | 781.94 g/mol |
| Exact Mass | 781.32 |
| IUPAC Name | 1,3-bis(3,5-ditert-butylphenyl)imidazolidin-2-ide;dichloro-[[2-[methanidyl(propan-2-yl)oxonio]phenyl]methylidene]ruthenium |
| SMILES | CC(C)(C)c1cc(N2[CH-]N(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)CC2)cc(C(C)(C)C)c1.[CH2-][O+](c1ccccc1C=[Ru](Cl)Cl)C(C)C |
| InChI | InChI=1S/C31H47N2.C11H14O.2ClH.Ru/c1-28(2,3)22-15-23(29(4,5)6)18-26(17-22)32-13-14-33(21-32)27-19-24(30(7,8)9)16-25(20-27)31(10,11)12;1-9(2)12(4)11-8-6-5-7-10(11)3;;;/h15-21H,13-14H2,1-12H3;3,5-9H,4H2,1-2H3;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | DEPIDDZPAQDYAE-UHFFFAOYSA-L |
| XLogP | 12.55 |
| TPSA | 9.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.94 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|