C35H48Cl2N2ORu — CID 59566366
1-(3,5-ditert-butylphenyl)-3-(3,5-dimethylphenyl)imidazolidin-2-ide;dichloro-[(2-propan-2-yloxoniophenyl)methylidene]ruthenium (PubChem CID 59566366) has the molecular formula C35H48Cl2N2ORu and a molecular weight of 684.76 g/mol. Its IUPAC name is 1-(3,5-ditert-butylphenyl)-3-(3,5-dimethylphenyl)imidazolidin-2-ide;dichloro-[(2-propan-2-yloxoniophenyl)methylidene]ruthenium.
| Compound Name | 1-(3,5-ditert-butylphenyl)-3-(3,5-dimethylphenyl)imidazolidin-2-ide;dichloro-[(2-propan-2-yloxoniophenyl)methylidene]ruthenium |
|---|---|
| PubChem CID | 59566366 |
| Molecular Formula | C35H48Cl2N2ORu |
| Molecular Weight | 684.76 g/mol |
| Exact Mass | 684.22 |
| IUPAC Name | 1-(3,5-ditert-butylphenyl)-3-(3,5-dimethylphenyl)imidazolidin-2-ide;dichloro-[(2-propan-2-yloxoniophenyl)methylidene]ruthenium |
| SMILES | CC(C)[OH+]c1ccccc1C=[Ru](Cl)Cl.Cc1cc(C)cc(N2[CH-]N(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)CC2)c1 |
| InChI | InChI=1S/C25H35N2.C10H12O.2ClH.Ru/c1-18-11-19(2)13-22(12-18)26-9-10-27(17-26)23-15-20(24(3,4)5)14-21(16-23)25(6,7)8;1-8(2)11-10-7-5-4-6-9(10)3;;;/h11-17H,9-10H2,1-8H3;3-8H,1-2H3;2*1H;/q-1;;;;+2/p-1 |
| InChIKey | ULHUFXMDABVYRH-UHFFFAOYSA-M |
| XLogP | 9.76 |
| TPSA | 19.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.76 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|