C30H38Cl3N3ORuS — CID 153290791
dichloro-[[5-chloro-2-(N-methyl-2-propan-2-yloxonioanilino)phenyl]methylidene]ruthenium;1-methylsulfanyl-3-(2,4,6-trimethylphenyl)imidazolidin-2-ide (PubChem CID 153290791) has the molecular formula C30H38Cl3N3ORuS and a molecular weight of 696.15 g/mol. Its IUPAC name is dichloro-[[5-chloro-2-(N-methyl-2-propan-2-yloxonioanilino)phenyl]methylidene]ruthenium;1-methylsulfanyl-3-(2,4,6-trimethylphenyl)imidazolidin-2-ide.
| Compound Name | dichloro-[[5-chloro-2-(N-methyl-2-propan-2-yloxonioanilino)phenyl]methylidene]ruthenium;1-methylsulfanyl-3-(2,4,6-trimethylphenyl)imidazolidin-2-ide |
|---|---|
| PubChem CID | 153290791 |
| Molecular Formula | C30H38Cl3N3ORuS |
| Molecular Weight | 696.15 g/mol |
| Exact Mass | 695.08 |
| IUPAC Name | dichloro-[[5-chloro-2-(N-methyl-2-propan-2-yloxonioanilino)phenyl]methylidene]ruthenium;1-methylsulfanyl-3-(2,4,6-trimethylphenyl)imidazolidin-2-ide |
| SMILES | CC(C)[OH+]c1ccccc1N(C)c1ccc(Cl)cc1C=[Ru](Cl)Cl.CSN1[CH-]N(c2c(C)cc(C)cc2C)CC1 |
| InChI | InChI=1S/C17H18ClNO.C13H19N2S.2ClH.Ru/c1-12(2)20-17-8-6-5-7-16(17)19(4)15-10-9-14(18)11-13(15)3;1-10-7-11(2)13(12(3)8-10)14-5-6-15(9-14)16-4;;;/h3,5-12H,1-2,4H3;7-9H,5-6H2,1-4H3;2*1H;/q;-1;;;+2/p-1 |
| InChIKey | AYTYUVUDWSPVLC-UHFFFAOYSA-M |
| XLogP | 8.96 |
| TPSA | 22.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.15 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|