C45H54ClN3ORu- — CID 161396240
2-(1-adamantyliminomethyl)phenol;benzylidene(chloro)ruthenium;1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide (PubChem CID 161396240) has the molecular formula C45H54ClN3ORu- and a molecular weight of 789.47 g/mol. Its IUPAC name is 2-(1-adamantyliminomethyl)phenol;benzylidene(chloro)ruthenium;1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide.
| Compound Name | 2-(1-adamantyliminomethyl)phenol;benzylidene(chloro)ruthenium;1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide |
|---|---|
| PubChem CID | 161396240 |
| Molecular Formula | C45H54ClN3ORu- |
| Molecular Weight | 789.47 g/mol |
| Exact Mass | 789.30 |
| IUPAC Name | 2-(1-adamantyliminomethyl)phenol;benzylidene(chloro)ruthenium;1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide |
| SMILES | Cc1cc(C)c(N2[CH-]N(c3c(C)cc(C)cc3C)CC2)c(C)c1.Cl/[Ru]=C/c1ccccc1.Oc1ccccc1/C=N/C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H27N2.C17H21NO.C7H6.ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;19-16-4-2-1-3-15(16)11-18-17-8-12-5-13(9-17)7-14(6-12)10-17;1-7-5-3-2-4-6-7;;/h9-13H,7-8H2,1-6H3;1-4,11-14,19H,5-10H2;1-6H;1H;/q-1;;;;+1/p-1/b;18-11+;;; |
| InChIKey | BVGVHNGLBIDZGQ-XFGZXXNWSA-M |
| XLogP | 10.84 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.47 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|