C33H51BN2 — CID 177394764
tert-butylimino-[1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethyl-3H-pyrrol-1-ium-5-yl]-(2,4,6-trimethylphenyl)boranuide (PubChem CID 177394764) has the molecular formula C33H51BN2 and a molecular weight of 486.60 g/mol. Its IUPAC name is tert-butylimino-[1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethyl-3H-pyrrol-1-ium-5-yl]-(2,4,6-trimethylphenyl)boranuide.
| Compound Name | tert-butylimino-[1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethyl-3H-pyrrol-1-ium-5-yl]-(2,4,6-trimethylphenyl)boranuide |
|---|---|
| PubChem CID | 177394764 |
| Molecular Formula | C33H51BN2 |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.41 |
| IUPAC Name | tert-butylimino-[1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethyl-3H-pyrrol-1-ium-5-yl]-(2,4,6-trimethylphenyl)boranuide |
| SMILES | Cc1cc(C)c(/[B-](=N\C(C)(C)C)C2=[N+](c3c(C(C)C)cccc3C(C)C)C(C)(C)CC2(C)C)c(C)c1 |
| InChI | InChI=1S/C33H51BN2/c1-21(2)26-16-15-17-27(22(3)4)29(26)36-30(32(11,12)20-33(36,13)14)34(35-31(8,9)10)28-24(6)18-23(5)19-25(28)7/h15-19,21-22H,20H2,1-14H3 |
| InChIKey | PVRVTMDZKLHNKS-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|