C28H39N2O+ — CID 158899864
N,3-bis[2,6-di(propan-2-yl)phenyl]-4-methyl-2H-1,3-oxazol-3-ium-5-imine (PubChem CID 158899864) has the molecular formula C28H39N2O+ and a molecular weight of 419.63 g/mol. Its IUPAC name is N,3-bis[2,6-di(propan-2-yl)phenyl]-4-methyl-2H-1,3-oxazol-3-ium-5-imine.
| Compound Name | N,3-bis[2,6-di(propan-2-yl)phenyl]-4-methyl-2H-1,3-oxazol-3-ium-5-imine |
|---|---|
| PubChem CID | 158899864 |
| Molecular Formula | C28H39N2O+ |
| Molecular Weight | 419.63 g/mol |
| Exact Mass | 419.31 |
| IUPAC Name | N,3-bis[2,6-di(propan-2-yl)phenyl]-4-methyl-2H-1,3-oxazol-3-ium-5-imine |
| SMILES | CC1=[N+](c2c(C(C)C)cccc2C(C)C)CO/C1=N\c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C28H39N2O/c1-17(2)22-12-10-13-23(18(3)4)26(22)29-28-21(9)30(16-31-28)27-24(19(5)6)14-11-15-25(27)20(7)8/h10-15,17-20H,16H2,1-9H3/q+1/b29-28- |
| InChIKey | WAPKWNLFQXPESR-ZIADKAODSA-N |
| XLogP | 8.00 |
| TPSA | 24.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.63 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|