C25H29N — CID 46867979
N-[2,6-di(propan-2-yl)phenyl]-1,2,3,4-tetrahydrofluoren-9-imine (PubChem CID 46867979) has the molecular formula C25H29N and a molecular weight of 343.51 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-1,2,3,4-tetrahydrofluoren-9-imine.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-1,2,3,4-tetrahydrofluoren-9-imine |
|---|---|
| PubChem CID | 46867979 |
| Molecular Formula | C25H29N |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-1,2,3,4-tetrahydrofluoren-9-imine |
| SMILES | CC(C)c1cccc(C(C)C)c1N=C1C2=C(CCCC2)c2ccccc21 |
| InChI | InChI=1S/C25H29N/c1-16(2)18-14-9-15-19(17(3)4)24(18)26-25-22-12-7-5-10-20(22)21-11-6-8-13-23(21)25/h5,7,9-10,12,14-17H,6,8,11,13H2,1-4H3 |
| InChIKey | DELLLRTYGLVBCN-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|