C23H24N2 — CID 46867838
N-[2,6-di(propan-2-yl)phenyl]pyrrolo[1,2-a]indol-4-imine (PubChem CID 46867838) has the molecular formula C23H24N2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]pyrrolo[1,2-a]indol-4-imine.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]pyrrolo[1,2-a]indol-4-imine |
|---|---|
| PubChem CID | 46867838 |
| Molecular Formula | C23H24N2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]pyrrolo[1,2-a]indol-4-imine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C1/c2ccccc2-n2cccc21 |
| InChI | InChI=1S/C23H24N2/c1-15(2)17-10-7-11-18(16(3)4)22(17)24-23-19-9-5-6-12-20(19)25-14-8-13-21(23)25/h5-16H,1-4H3/b24-23- |
| InChIKey | GACULPWJJFSDKB-VHXPQNKSSA-N |
| XLogP | 6.21 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|