C42H50N2O — CID 139157818
9-N,10-N-bis[2,6-di(propan-2-yl)phenyl]phenanthrene-9,10-diimine;oxolane (PubChem CID 139157818) has the molecular formula C42H50N2O and a molecular weight of 598.88 g/mol. Its IUPAC name is 9-N,10-N-bis[2,6-di(propan-2-yl)phenyl]phenanthrene-9,10-diimine;oxolane.
| Compound Name | 9-N,10-N-bis[2,6-di(propan-2-yl)phenyl]phenanthrene-9,10-diimine;oxolane |
|---|---|
| PubChem CID | 139157818 |
| Molecular Formula | C42H50N2O |
| Molecular Weight | 598.88 g/mol |
| Exact Mass | 598.39 |
| IUPAC Name | 9-N,10-N-bis[2,6-di(propan-2-yl)phenyl]phenanthrene-9,10-diimine;oxolane |
| SMILES | C1CCOC1.CC(C)c1cccc(C(C)C)c1/N=C1C(=N/c2c(C(C)C)cccc2C(C)C)/c2ccccc2-c2ccccc2/1 |
| InChI | InChI=1S/C38H42N2.C4H8O/c1-23(2)27-19-13-20-28(24(3)4)35(27)39-37-33-17-11-9-15-31(33)32-16-10-12-18-34(32)38(37)40-36-29(25(5)6)21-14-22-30(36)26(7)8;1-2-4-5-3-1/h9-26H,1-8H3;1-4H2/b39-37+,40-38+; |
| InChIKey | WYANTGHHGZXJDL-IJKDMPGWSA-N |
| XLogP | 11.90 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.88 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|