C23H28N2O — CID 139203243
3-[2,6-di(propan-2-yl)phenyl]imino-1,4,7-trimethylindol-2-one (PubChem CID 139203243) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]imino-1,4,7-trimethylindol-2-one.
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]imino-1,4,7-trimethylindol-2-one |
|---|---|
| PubChem CID | 139203243 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]imino-1,4,7-trimethylindol-2-one |
| SMILES | Cc1ccc(C)c2c1/C(=N/c1c(C(C)C)cccc1C(C)C)C(=O)N2C |
| InChI | InChI=1S/C23H28N2O/c1-13(2)17-9-8-10-18(14(3)4)20(17)24-21-19-15(5)11-12-16(6)22(19)25(7)23(21)26/h8-14H,1-7H3/b24-21- |
| InChIKey | QJTZHEZNUWQBCC-FLFQWRMESA-N |
| XLogP | 5.65 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|