C26H32N2O2 — CID 177402644
CID 177402644 (PubChem CID 177402644) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol.
| Compound Name | CID 177402644 |
|---|---|
| PubChem CID | 177402644 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C(C)C)c1N1[C]N(c2c(C)cccc2C(C)C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C26H32N2O2/c1-16(2)20-13-9-11-18(5)22(20)27-15-28(25(30)26(7,8)24(27)29)23-19(6)12-10-14-21(23)17(3)4/h9-14,16-17H,1-8H3 |
| InChIKey | UKJDHXNEJJWSGI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|