C17H17N3O4 — CID 175692223
1-(2-methyl-6-propan-2-ylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,4,5,7-tetrone (PubChem CID 175692223) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 1-(2-methyl-6-propan-2-ylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,4,5,7-tetrone.
| Compound Name | 1-(2-methyl-6-propan-2-ylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,4,5,7-tetrone |
|---|---|
| PubChem CID | 175692223 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-(2-methyl-6-propan-2-ylphenyl)-8H-pyrido[2,3-d]pyrimidine-2,4,5,7-tetrone |
| SMILES | Cc1cccc(C(C)C)c1-n1c2c(c(=O)[nH]c1=O)C(=O)CC(=O)N2 |
| InChI | InChI=1S/C17H17N3O4/c1-8(2)10-6-4-5-9(3)14(10)20-15-13(16(23)19-17(20)24)11(21)7-12(22)18-15/h4-6,8H,7H2,1-3H3,(H,18,22)(H,19,23,24) |
| InChIKey | QMZCHVFZNILOEW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|