C16H23NO — CID 171748299
3,3-dimethyl-1,4-di(propan-2-yl)indol-2-one (PubChem CID 171748299) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 3,3-dimethyl-1,4-di(propan-2-yl)indol-2-one.
| Compound Name | 3,3-dimethyl-1,4-di(propan-2-yl)indol-2-one |
|---|---|
| PubChem CID | 171748299 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 3,3-dimethyl-1,4-di(propan-2-yl)indol-2-one |
| SMILES | CC(C)c1cccc2c1C(C)(C)C(=O)N2C(C)C |
| InChI | InChI=1S/C16H23NO/c1-10(2)12-8-7-9-13-14(12)16(5,6)15(18)17(13)11(3)4/h7-11H,1-6H3 |
| InChIKey | PKGRLGSLKREFJH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |