C14H16F3NO — CID 102133533
3-methyl-1-propan-2-yl-3-(2,2,2-trifluoroethyl)indol-2-one (PubChem CID 102133533) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is 3-methyl-1-propan-2-yl-3-(2,2,2-trifluoroethyl)indol-2-one.
| Compound Name | 3-methyl-1-propan-2-yl-3-(2,2,2-trifluoroethyl)indol-2-one |
|---|---|
| PubChem CID | 102133533 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-methyl-1-propan-2-yl-3-(2,2,2-trifluoroethyl)indol-2-one |
| SMILES | CC(C)N1C(=O)C(C)(CC(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C14H16F3NO/c1-9(2)18-11-7-5-4-6-10(11)13(3,12(18)19)8-14(15,16)17/h4-7,9H,8H2,1-3H3 |
| InChIKey | JLZTYNYDALCMDX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |