C14H18F3N — CID 175173541
1,2,2,3-tetramethyl-3-(2,2,2-trifluoroethyl)indole (PubChem CID 175173541) has the molecular formula C14H18F3N and a molecular weight of 257.30 g/mol. Its IUPAC name is 1,2,2,3-tetramethyl-3-(2,2,2-trifluoroethyl)indole.
| Compound Name | 1,2,2,3-tetramethyl-3-(2,2,2-trifluoroethyl)indole |
|---|---|
| PubChem CID | 175173541 |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1,2,2,3-tetramethyl-3-(2,2,2-trifluoroethyl)indole |
| SMILES | CN1c2ccccc2C(C)(CC(F)(F)F)C1(C)C |
| InChI | InChI=1S/C14H18F3N/c1-12(2)13(3,9-14(15,16)17)10-7-5-6-8-11(10)18(12)4/h5-8H,9H2,1-4H3 |
| InChIKey | GFGMKEMPHLSAEH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |