C23H29NO — CID 136738238
(1S)-3-[2,6-di(propan-2-yl)phenyl]imino-1,7-dimethyl-1,2-dihydroinden-4-ol (PubChem CID 136738238) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (1S)-3-[2,6-di(propan-2-yl)phenyl]imino-1,7-dimethyl-1,2-dihydroinden-4-ol.
| Compound Name | (1S)-3-[2,6-di(propan-2-yl)phenyl]imino-1,7-dimethyl-1,2-dihydroinden-4-ol |
|---|---|
| PubChem CID | 136738238 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (1S)-3-[2,6-di(propan-2-yl)phenyl]imino-1,7-dimethyl-1,2-dihydroinden-4-ol |
| SMILES | Cc1ccc(O)c2c1[C@@H](C)C/C2=N\c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C23H29NO/c1-13(2)17-8-7-9-18(14(3)4)23(17)24-19-12-16(6)21-15(5)10-11-20(25)22(19)21/h7-11,13-14,16,25H,12H2,1-6H3/b24-19+/t16-/m0/s1 |
| InChIKey | DMHFHWXIWRXJQI-UAFKWENTSA-N |
| XLogP | 6.58 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|