C36H42N2 — CID 91376559
1-N,2-N-bis[2,6-di(propan-2-yl)phenyl]-3,3a-dihydroacenaphthylene-1,2-diimine (PubChem CID 91376559) has the molecular formula C36H42N2 and a molecular weight of 502.75 g/mol. Its IUPAC name is 1-N,2-N-bis[2,6-di(propan-2-yl)phenyl]-3,3a-dihydroacenaphthylene-1,2-diimine.
| Compound Name | 1-N,2-N-bis[2,6-di(propan-2-yl)phenyl]-3,3a-dihydroacenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 91376559 |
| Molecular Formula | C36H42N2 |
| Molecular Weight | 502.75 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | 1-N,2-N-bis[2,6-di(propan-2-yl)phenyl]-3,3a-dihydroacenaphthylene-1,2-diimine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C1C(=N/c2c(C(C)C)cccc2C(C)C)/C2CC=Cc3cccc/1c32 |
| InChI | InChI=1S/C36H42N2/c1-21(2)26-15-11-16-27(22(3)4)33(26)37-35-30-19-9-13-25-14-10-20-31(32(25)30)36(35)38-34-28(23(5)6)17-12-18-29(34)24(7)8/h9-19,21-24,31H,20H2,1-8H3/b37-35+,38-36+ |
| InChIKey | PEHRVTWQHSITKT-ATXIYDNESA-N |
| XLogP | 10.59 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.75 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|