C21H16 — CID 143667787
pentacyclo[9.7.2.12,6.015,19.010,21]henicosa-1(18),4,6(21),7,9,11,13,15(19),16-nonaene (PubChem CID 143667787) has the molecular formula C21H16 and a molecular weight of 268.36 g/mol. Its IUPAC name is pentacyclo[9.7.2.12,6.015,19.010,21]henicosa-1(18),4,6(21),7,9,11,13,15(19),16-nonaene.
| Compound Name | pentacyclo[9.7.2.12,6.015,19.010,21]henicosa-1(18),4,6(21),7,9,11,13,15(19),16-nonaene |
|---|---|
| PubChem CID | 143667787 |
| Molecular Formula | C21H16 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | pentacyclo[9.7.2.12,6.015,19.010,21]henicosa-1(18),4,6(21),7,9,11,13,15(19),16-nonaene |
| SMILES | C1=Cc2cccc3c2CC(=C1)c1cccc2c1C3CC=C2 |
| InChI | InChI=1S/C21H16/c1-5-14-6-2-11-18-19-12-4-8-15-7-3-10-17(21(15)19)16(9-1)13-20(14)18/h1-11,19H,12-13H2 |
| InChIKey | ZMXXIDKNCSJNEO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |