C43H68N2Si+2 — CID 162267449
4-[1,3-bis[2,6-di(propan-2-yl)phenyl]-5-methyl-2H-imidazole-1,3-diium-4-yl]butyl-dicyclopentyl-methylsilane (PubChem CID 162267449) has the molecular formula C43H68N2Si+2 and a molecular weight of 641.12 g/mol. Its IUPAC name is 4-[1,3-bis[2,6-di(propan-2-yl)phenyl]-5-methyl-2H-imidazole-1,3-diium-4-yl]butyl-dicyclopentyl-methylsilane.
| Compound Name | 4-[1,3-bis[2,6-di(propan-2-yl)phenyl]-5-methyl-2H-imidazole-1,3-diium-4-yl]butyl-dicyclopentyl-methylsilane |
|---|---|
| PubChem CID | 162267449 |
| Molecular Formula | C43H68N2Si+2 |
| Molecular Weight | 641.12 g/mol |
| Exact Mass | 640.51 |
| IUPAC Name | 4-[1,3-bis[2,6-di(propan-2-yl)phenyl]-5-methyl-2H-imidazole-1,3-diium-4-yl]butyl-dicyclopentyl-methylsilane |
| SMILES | CC1=[N+](c2c(C(C)C)cccc2C(C)C)C[N+](c2c(C(C)C)cccc2C(C)C)=C1CCCC[Si](C)(C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C43H68N2Si/c1-30(2)37-23-17-24-38(31(3)4)42(37)44-29-45(43-39(32(5)6)25-18-26-40(43)33(7)8)41(34(44)9)27-15-16-28-46(10,35-19-11-12-20-35)36-21-13-14-22-36/h17-18,23-26,30-33,35-36H,11-16,19-22,27-29H2,1-10H3/q+2 |
| InChIKey | DKSRDYUFAJDDJK-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.12 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|