C28H34N+ — CID 167496233
1-[2,6-di(propan-2-yl)phenyl]-2,2-dimethyl-4-naphthalen-1-yl-3,4-dihydropyrrol-1-ium (PubChem CID 167496233) has the molecular formula C28H34N+ and a molecular weight of 384.59 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-2,2-dimethyl-4-naphthalen-1-yl-3,4-dihydropyrrol-1-ium.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-2,2-dimethyl-4-naphthalen-1-yl-3,4-dihydropyrrol-1-ium |
|---|---|
| PubChem CID | 167496233 |
| Molecular Formula | C28H34N+ |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-2,2-dimethyl-4-naphthalen-1-yl-3,4-dihydropyrrol-1-ium |
| SMILES | CC(C)c1cccc(C(C)C)c1[N+]1=CC(c2cccc3ccccc23)CC1(C)C |
| InChI | InChI=1S/C28H34N/c1-19(2)23-14-10-15-24(20(3)4)27(23)29-18-22(17-28(29,5)6)26-16-9-12-21-11-7-8-13-25(21)26/h7-16,18-20,22H,17H2,1-6H3/q+1 |
| InChIKey | HOTLOIALRIJDQI-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|