C20H32BF4N — CID 119026240
1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethyl-3H-pyrrol-1-ium tetrafluoroborate (PubChem CID 119026240) has the molecular formula C20H32BF4N and a molecular weight of 373.29 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethyl-3H-pyrrol-1-ium tetrafluoroborate.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethyl-3H-pyrrol-1-ium tetrafluoroborate |
|---|---|
| PubChem CID | 119026240 |
| Molecular Formula | C20H32BF4N |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-2,2,4,4-tetramethyl-3H-pyrrol-1-ium tetrafluoroborate |
| SMILES | CC(C)c1cccc(C(C)C)c1[N+]1=CC(C)(C)CC1(C)C.F[B-](F)(F)F |
| InChI | InChI=1S/C20H32N.BF4/c1-14(2)16-10-9-11-17(15(3)4)18(16)21-13-19(5,6)12-20(21,7)8;2-1(3,4)5/h9-11,13-15H,12H2,1-8H3;/q+1;-1 |
| InChIKey | GUSVHDDKSPZUEG-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|