C35H45NP+ — CID 132582254
[2-[2,6-di(propan-2-yl)phenyl]-3,3-dimethyl-2-azoniaspiro[4.5]dec-1-en-1-yl]-diphenylphosphane (PubChem CID 132582254) has the molecular formula C35H45NP+ and a molecular weight of 510.73 g/mol. Its IUPAC name is [2-[2,6-di(propan-2-yl)phenyl]-3,3-dimethyl-2-azoniaspiro[4.5]dec-1-en-1-yl]-diphenylphosphane.
| Compound Name | [2-[2,6-di(propan-2-yl)phenyl]-3,3-dimethyl-2-azoniaspiro[4.5]dec-1-en-1-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 132582254 |
| Molecular Formula | C35H45NP+ |
| Molecular Weight | 510.73 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | [2-[2,6-di(propan-2-yl)phenyl]-3,3-dimethyl-2-azoniaspiro[4.5]dec-1-en-1-yl]-diphenylphosphane |
| SMILES | CC(C)c1cccc(C(C)C)c1[N+]1=C(P(c2ccccc2)c2ccccc2)C2(CCCCC2)CC1(C)C |
| InChI | InChI=1S/C35H45NP/c1-26(2)30-21-16-22-31(27(3)4)32(30)36-33(35(25-34(36,5)6)23-14-9-15-24-35)37(28-17-10-7-11-18-28)29-19-12-8-13-20-29/h7-8,10-13,16-22,26-27H,9,14-15,23-25H2,1-6H3/q+1 |
| InChIKey | DFHYMQOOFAPFFQ-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.73 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|