C22H28N+ — CID 167496229
1-(2,6-diethylphenyl)-2,2-dimethyl-4-phenyl-3,4-dihydropyrrol-1-ium (PubChem CID 167496229) has the molecular formula C22H28N+ and a molecular weight of 306.47 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-2,2-dimethyl-4-phenyl-3,4-dihydropyrrol-1-ium.
| Compound Name | 1-(2,6-diethylphenyl)-2,2-dimethyl-4-phenyl-3,4-dihydropyrrol-1-ium |
|---|---|
| PubChem CID | 167496229 |
| Molecular Formula | C22H28N+ |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 1-(2,6-diethylphenyl)-2,2-dimethyl-4-phenyl-3,4-dihydropyrrol-1-ium |
| SMILES | CCc1cccc(CC)c1[N+]1=CC(c2ccccc2)CC1(C)C |
| InChI | InChI=1S/C22H28N/c1-5-17-13-10-14-18(6-2)21(17)23-16-20(15-22(23,3)4)19-11-8-7-9-12-19/h7-14,16,20H,5-6,15H2,1-4H3/q+1 |
| InChIKey | BBQYTPUNCQTIPJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|