C32H41N2+ — CID 122212305
(4S)-4-benzyl-1-[2,6-di(propan-2-yl)phenyl]-3-[(2,4,6-trimethylphenyl)methyl]-4,5-dihydroimidazol-3-ium (PubChem CID 122212305) has the molecular formula C32H41N2+ and a molecular weight of 453.69 g/mol. Its IUPAC name is (4S)-4-benzyl-1-[2,6-di(propan-2-yl)phenyl]-3-[(2,4,6-trimethylphenyl)methyl]-4,5-dihydroimidazol-3-ium.
| Compound Name | (4S)-4-benzyl-1-[2,6-di(propan-2-yl)phenyl]-3-[(2,4,6-trimethylphenyl)methyl]-4,5-dihydroimidazol-3-ium |
|---|---|
| PubChem CID | 122212305 |
| Molecular Formula | C32H41N2+ |
| Molecular Weight | 453.69 g/mol |
| Exact Mass | 453.33 |
| IUPAC Name | (4S)-4-benzyl-1-[2,6-di(propan-2-yl)phenyl]-3-[(2,4,6-trimethylphenyl)methyl]-4,5-dihydroimidazol-3-ium |
| SMILES | Cc1cc(C)c(C[N+]2=CN(c3c(C(C)C)cccc3C(C)C)C[C@@H]2Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C32H41N2/c1-22(2)29-14-11-15-30(23(3)4)32(29)34-19-28(18-27-12-9-8-10-13-27)33(21-34)20-31-25(6)16-24(5)17-26(31)7/h8-17,21-23,28H,18-20H2,1-7H3/q+1/t28-/m0/s1 |
| InChIKey | AHVHQDZCOWVEGM-NDEPHWFRSA-N |
| XLogP | 7.53 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.69 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|