C26H29N2+ — CID 42643997
1-benzhydryl-3-[(2,4,6-trimethylphenyl)methyl]-4,5-dihydroimidazol-3-ium (PubChem CID 42643997) has the molecular formula C26H29N2+ and a molecular weight of 369.53 g/mol. Its IUPAC name is 1-benzhydryl-3-[(2,4,6-trimethylphenyl)methyl]-4,5-dihydroimidazol-3-ium.
| Compound Name | 1-benzhydryl-3-[(2,4,6-trimethylphenyl)methyl]-4,5-dihydroimidazol-3-ium |
|---|---|
| PubChem CID | 42643997 |
| Molecular Formula | C26H29N2+ |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 1-benzhydryl-3-[(2,4,6-trimethylphenyl)methyl]-4,5-dihydroimidazol-3-ium |
| SMILES | Cc1cc(C)c(C[N+]2=CN(C(c3ccccc3)c3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C26H29N2/c1-20-16-21(2)25(22(3)17-20)18-27-14-15-28(19-27)26(23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-13,16-17,19,26H,14-15,18H2,1-3H3/q+1 |
| InChIKey | WRFLKCNTDNZTJZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|