C22H22NS+ — CID 149225033
[2-(aziridin-1-yl)-4,6-dimethylphenyl]-diphenylsulfanium (PubChem CID 149225033) has the molecular formula C22H22NS+ and a molecular weight of 332.49 g/mol. Its IUPAC name is [2-(aziridin-1-yl)-4,6-dimethylphenyl]-diphenylsulfanium.
| Compound Name | [2-(aziridin-1-yl)-4,6-dimethylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 149225033 |
| Molecular Formula | C22H22NS+ |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | [2-(aziridin-1-yl)-4,6-dimethylphenyl]-diphenylsulfanium |
| SMILES | Cc1cc(C)c([S+](c2ccccc2)c2ccccc2)c(N2CC2)c1 |
| InChI | InChI=1S/C22H22NS/c1-17-15-18(2)22(21(16-17)23-13-14-23)24(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,15-16H,13-14H2,1-2H3/q+1 |
| InChIKey | XJEPYHDEGNKFHI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|