C23H24O2S — CID 86209985
diphenyl-(2,4,6-trimethylphenyl)sulfanium acetate (PubChem CID 86209985) has the molecular formula C23H24O2S and a molecular weight of 364.51 g/mol. Its IUPAC name is diphenyl-(2,4,6-trimethylphenyl)sulfanium acetate.
| Compound Name | diphenyl-(2,4,6-trimethylphenyl)sulfanium acetate |
|---|---|
| PubChem CID | 86209985 |
| Molecular Formula | C23H24O2S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | diphenyl-(2,4,6-trimethylphenyl)sulfanium acetate |
| SMILES | CC(=O)[O-].Cc1cc(C)c([S+](c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C21H21S.C2H4O2/c1-16-14-17(2)21(18(3)15-16)22(19-10-6-4-7-11-19)20-12-8-5-9-13-20;1-2(3)4/h4-15H,1-3H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | TWGBDCLPFRZRJS-UHFFFAOYSA-M |
| XLogP | 4.46 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|