C23H23ClN2 — CID 139240229
1-phenyl-3-[(2,4,6-trimethylphenyl)methyl]benzimidazol-3-ium chloride (PubChem CID 139240229) has the molecular formula C23H23ClN2 and a molecular weight of 362.90 g/mol. Its IUPAC name is 1-phenyl-3-[(2,4,6-trimethylphenyl)methyl]benzimidazol-3-ium chloride.
| Compound Name | 1-phenyl-3-[(2,4,6-trimethylphenyl)methyl]benzimidazol-3-ium chloride |
|---|---|
| PubChem CID | 139240229 |
| Molecular Formula | C23H23ClN2 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1-phenyl-3-[(2,4,6-trimethylphenyl)methyl]benzimidazol-3-ium chloride |
| SMILES | Cc1cc(C)c(C[n+]2cn(-c3ccccc3)c3ccccc32)c(C)c1.[Cl-] |
| InChI | InChI=1S/C23H23N2.ClH/c1-17-13-18(2)21(19(3)14-17)15-24-16-25(20-9-5-4-6-10-20)23-12-8-7-11-22(23)24;/h4-14,16H,15H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | WXVJSBQLDXVGHR-UHFFFAOYSA-M |
| XLogP | 1.90 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|