C23H23ClN2O3 — CID 139240231
1-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-3-ium chloride (PubChem CID 139240231) has the molecular formula C23H23ClN2O3 and a molecular weight of 410.90 g/mol. Its IUPAC name is 1-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-3-ium chloride.
| Compound Name | 1-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-3-ium chloride |
|---|---|
| PubChem CID | 139240231 |
| Molecular Formula | C23H23ClN2O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 1-phenyl-3-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-3-ium chloride |
| SMILES | COc1cc(C[n+]2cn(-c3ccccc3)c3ccccc32)cc(OC)c1OC.[Cl-] |
| InChI | InChI=1S/C23H23N2O3.ClH/c1-26-21-13-17(14-22(27-2)23(21)28-3)15-24-16-25(18-9-5-4-6-10-18)20-12-8-7-11-19(20)24;/h4-14,16H,15H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | WDCPFZQOPJLJDO-UHFFFAOYSA-M |
| XLogP | 1.00 |
| TPSA | 36.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|