C29H31ClN2O5 — CID 138757245
1-[(6-ethoxy-2H-chromen-4-yl)methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-3-ium chloride (PubChem CID 138757245) has the molecular formula C29H31ClN2O5 and a molecular weight of 523.03 g/mol. Its IUPAC name is 1-[(6-ethoxy-2H-chromen-4-yl)methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-3-ium chloride.
| Compound Name | 1-[(6-ethoxy-2H-chromen-4-yl)methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-3-ium chloride |
|---|---|
| PubChem CID | 138757245 |
| Molecular Formula | C29H31ClN2O5 |
| Molecular Weight | 523.03 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 1-[(6-ethoxy-2H-chromen-4-yl)methyl]-3-[(3,4,5-trimethoxyphenyl)methyl]benzimidazol-3-ium chloride |
| SMILES | CCOc1ccc2c(c1)C(Cn1c[n+](Cc3cc(OC)c(OC)c(OC)c3)c3ccccc31)=CCO2.[Cl-] |
| InChI | InChI=1S/C29H31N2O5.ClH/c1-5-35-22-10-11-26-23(16-22)21(12-13-36-26)18-31-19-30(24-8-6-7-9-25(24)31)17-20-14-27(32-2)29(34-4)28(15-20)33-3;/h6-12,14-16,19H,5,13,17-18H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | RQXSNJFZGROLBH-UHFFFAOYSA-M |
| XLogP | 1.88 |
| TPSA | 54.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.03 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|