C57H48N4+2 — CID 164703672
1-[3-(2,4,6-trimethylphenyl)phenyl]-3-[9-[3-[3-(2,4,6-trimethylphenyl)phenyl]benzimidazol-1-ium-1-yl]fluoren-9-yl]benzimidazol-3-ium (PubChem CID 164703672) has the molecular formula C57H48N4+2 and a molecular weight of 789.04 g/mol. Its IUPAC name is 1-[3-(2,4,6-trimethylphenyl)phenyl]-3-[9-[3-[3-(2,4,6-trimethylphenyl)phenyl]benzimidazol-1-ium-1-yl]fluoren-9-yl]benzimidazol-3-ium.
| Compound Name | 1-[3-(2,4,6-trimethylphenyl)phenyl]-3-[9-[3-[3-(2,4,6-trimethylphenyl)phenyl]benzimidazol-1-ium-1-yl]fluoren-9-yl]benzimidazol-3-ium |
|---|---|
| PubChem CID | 164703672 |
| Molecular Formula | C57H48N4+2 |
| Molecular Weight | 789.04 g/mol |
| Exact Mass | 788.39 |
| IUPAC Name | 1-[3-(2,4,6-trimethylphenyl)phenyl]-3-[9-[3-[3-(2,4,6-trimethylphenyl)phenyl]benzimidazol-1-ium-1-yl]fluoren-9-yl]benzimidazol-3-ium |
| SMILES | Cc1cc(C)c(-c2cccc(-n3c[n+](C4([n+]5cn(-c6cccc(-c7c(C)cc(C)cc7C)c6)c6ccccc65)c5ccccc5-c5ccccc54)c4ccccc43)c2)c(C)c1 |
| InChI | InChI=1S/C57H48N4/c1-37-29-39(3)55(40(4)30-37)43-17-15-19-45(33-43)58-35-60(53-27-13-11-25-51(53)58)57(49-23-9-7-21-47(49)48-22-8-10-24-50(48)57)61-36-59(52-26-12-14-28-54(52)61)46-20-16-18-44(34-46)56-41(5)31-38(2)32-42(56)6/h7-36H,1-6H3/q+2 |
| InChIKey | YZUMBHAMNZAUPY-UHFFFAOYSA-N |
| XLogP | 12.61 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.04 |
| LogP ≤ 5 | 12.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|