C28H32N4+2 — CID 102307018
1-tert-butyl-3-[3-(3-tert-butylbenzimidazol-3-ium-1-yl)phenyl]benzimidazol-1-ium (PubChem CID 102307018) has the molecular formula C28H32N4+2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(3-tert-butylbenzimidazol-3-ium-1-yl)phenyl]benzimidazol-1-ium.
| Compound Name | 1-tert-butyl-3-[3-(3-tert-butylbenzimidazol-3-ium-1-yl)phenyl]benzimidazol-1-ium |
|---|---|
| PubChem CID | 102307018 |
| Molecular Formula | C28H32N4+2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 1-tert-butyl-3-[3-(3-tert-butylbenzimidazol-3-ium-1-yl)phenyl]benzimidazol-1-ium |
| SMILES | CC(C)(C)[n+]1cn(-c2cccc(-n3c[n+](C(C)(C)C)c4ccccc43)c2)c2ccccc21 |
| InChI | InChI=1S/C28H32N4/c1-27(2,3)31-19-29(23-14-7-9-16-25(23)31)21-12-11-13-22(18-21)30-20-32(28(4,5)6)26-17-10-8-15-24(26)30/h7-20H,1-6H3/q+2 |
| InChIKey | QEGUOGPVYZFJTR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|